C15H10ClF2N3 — CID 175560635
7-chloro-5-(2,3-difluorophenyl)-3H-1,4-benzodiazepin-2-amine (PubChem CID 175560635) has the molecular formula C15H10ClF2N3 and a molecular weight of 305.72 g/mol. Its IUPAC name is 7-chloro-5-(2,3-difluorophenyl)-3H-1,4-benzodiazepin-2-amine.
| Compound Name | 7-chloro-5-(2,3-difluorophenyl)-3H-1,4-benzodiazepin-2-amine |
|---|---|
| PubChem CID | 175560635 |
| Molecular Formula | C15H10ClF2N3 |
| Molecular Weight | 305.72 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 7-chloro-5-(2,3-difluorophenyl)-3H-1,4-benzodiazepin-2-amine |
| SMILES | NC1=Nc2ccc(Cl)cc2C(c2cccc(F)c2F)=NC1 |
| InChI | InChI=1S/C15H10ClF2N3/c16-8-4-5-12-10(6-8)15(20-7-13(19)21-12)9-2-1-3-11(17)14(9)18/h1-6H,7H2,(H2,19,21) |
| InChIKey | SYDIPUZECTYHLB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.72 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |