C14H10Cl2N4 — CID 110181250
7-chloro-5-(2-chlorophenyl)-3H-pyrido[3,2-e][1,4]diazepin-2-amine (PubChem CID 110181250) has the molecular formula C14H10Cl2N4 and a molecular weight of 305.17 g/mol. Its IUPAC name is 7-chloro-5-(2-chlorophenyl)-3H-pyrido[3,2-e][1,4]diazepin-2-amine.
| Compound Name | 7-chloro-5-(2-chlorophenyl)-3H-pyrido[3,2-e][1,4]diazepin-2-amine |
|---|---|
| PubChem CID | 110181250 |
| Molecular Formula | C14H10Cl2N4 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 7-chloro-5-(2-chlorophenyl)-3H-pyrido[3,2-e][1,4]diazepin-2-amine |
| SMILES | NC1=Nc2ccc(Cl)nc2C(c2ccccc2Cl)=NC1 |
| InChI | InChI=1S/C14H10Cl2N4/c15-9-4-2-1-3-8(9)13-14-10(5-6-11(16)20-14)19-12(17)7-18-13/h1-6H,7H2,(H2,17,19) |
| InChIKey | HYWLXLQVIZHEPN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|