C15H15ClN4 — CID 135457989
7-chloro-N-methyl-4-phenyl-3,5-dihydro-1H-pyrido[3,2-e][1,4]diazepin-2-imine (PubChem CID 135457989) has the molecular formula C15H15ClN4 and a molecular weight of 286.77 g/mol. Its IUPAC name is 7-chloro-N-methyl-4-phenyl-3,5-dihydro-1H-pyrido[3,2-e][1,4]diazepin-2-imine.
| Compound Name | 7-chloro-N-methyl-4-phenyl-3,5-dihydro-1H-pyrido[3,2-e][1,4]diazepin-2-imine |
|---|---|
| PubChem CID | 135457989 |
| Molecular Formula | C15H15ClN4 |
| Molecular Weight | 286.77 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 7-chloro-N-methyl-4-phenyl-3,5-dihydro-1H-pyrido[3,2-e][1,4]diazepin-2-imine |
| SMILES | C/N=C1\CN(c2ccccc2)Cc2nc(Cl)ccc2N1 |
| InChI | InChI=1S/C15H15ClN4/c1-17-15-10-20(11-5-3-2-4-6-11)9-13-12(19-15)7-8-14(16)18-13/h2-8H,9-10H2,1H3,(H,17,19) |
| InChIKey | JRAVPEPRAUGIIX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.77 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|