C14H12ClN3S — CID 3002113
7-chloro-4-phenyl-3,5-dihydro-1H-pyrido[3,2-e][1,4]diazepine-2-thione (PubChem CID 3002113) has the molecular formula C14H12ClN3S and a molecular weight of 289.79 g/mol. Its IUPAC name is 7-chloro-4-phenyl-3,5-dihydro-1H-pyrido[3,2-e][1,4]diazepine-2-thione.
| Compound Name | 7-chloro-4-phenyl-3,5-dihydro-1H-pyrido[3,2-e][1,4]diazepine-2-thione |
|---|---|
| PubChem CID | 3002113 |
| Molecular Formula | C14H12ClN3S |
| Molecular Weight | 289.79 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 7-chloro-4-phenyl-3,5-dihydro-1H-pyrido[3,2-e][1,4]diazepine-2-thione |
| SMILES | S=C1CN(c2ccccc2)Cc2nc(Cl)ccc2N1 |
| InChI | InChI=1S/C14H12ClN3S/c15-13-7-6-11-12(16-13)8-18(9-14(19)17-11)10-4-2-1-3-5-10/h1-7H,8-9H2,(H,17,19) |
| InChIKey | SXKTTYYLIZTXQJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.79 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|