C15H15ClF3N3 — CID 175056743
6-chloro-3-N-phenyl-4-N-propan-2-yl-2-(trifluoromethyl)pyridine-3,4-diamine (PubChem CID 175056743) has the molecular formula C15H15ClF3N3 and a molecular weight of 329.75 g/mol. Its IUPAC name is 6-chloro-3-N-phenyl-4-N-propan-2-yl-2-(trifluoromethyl)pyridine-3,4-diamine.
| Compound Name | 6-chloro-3-N-phenyl-4-N-propan-2-yl-2-(trifluoromethyl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 175056743 |
| Molecular Formula | C15H15ClF3N3 |
| Molecular Weight | 329.75 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 6-chloro-3-N-phenyl-4-N-propan-2-yl-2-(trifluoromethyl)pyridine-3,4-diamine |
| SMILES | CC(C)Nc1cc(Cl)nc(C(F)(F)F)c1Nc1ccccc1 |
| InChI | InChI=1S/C15H15ClF3N3/c1-9(2)20-11-8-12(16)22-14(15(17,18)19)13(11)21-10-6-4-3-5-7-10/h3-9,21H,1-2H3,(H,20,22) |
| InChIKey | QAKGDCQHSQQZEE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.75 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|