C17H14FN3O — CID 67730065
1-[2-amino-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-7-yl]ethanone (PubChem CID 67730065) has the molecular formula C17H14FN3O and a molecular weight of 295.32 g/mol. Its IUPAC name is 1-[2-amino-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-7-yl]ethanone.
| Compound Name | 1-[2-amino-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-7-yl]ethanone |
|---|---|
| PubChem CID | 67730065 |
| Molecular Formula | C17H14FN3O |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 1-[2-amino-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-7-yl]ethanone |
| SMILES | CC(=O)c1ccc2c(c1)C(c1ccccc1F)=NCC(N)=N2 |
| InChI | InChI=1S/C17H14FN3O/c1-10(22)11-6-7-15-13(8-11)17(20-9-16(19)21-15)12-4-2-3-5-14(12)18/h2-8H,9H2,1H3,(H2,19,21) |
| InChIKey | LEQGWQAXLSXSAM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |