C18H19FN2O — CID 58608717
3-(4-fluorophenyl)-3-oxo-N'-(2,4,6-trimethylphenyl)propanimidamide (PubChem CID 58608717) has the molecular formula C18H19FN2O and a molecular weight of 298.36 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-3-oxo-N'-(2,4,6-trimethylphenyl)propanimidamide.
| Compound Name | 3-(4-fluorophenyl)-3-oxo-N'-(2,4,6-trimethylphenyl)propanimidamide |
|---|---|
| PubChem CID | 58608717 |
| Molecular Formula | C18H19FN2O |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 3-(4-fluorophenyl)-3-oxo-N'-(2,4,6-trimethylphenyl)propanimidamide |
| SMILES | Cc1cc(C)c(/N=C(/N)CC(=O)c2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C18H19FN2O/c1-11-8-12(2)18(13(3)9-11)21-17(20)10-16(22)14-4-6-15(19)7-5-14/h4-9H,10H2,1-3H3,(H2,20,21) |
| InChIKey | VJNWUMYUVWSOBF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|