C19H21FN2O — CID 58608514
N'-(2,6-diethylphenyl)-3-(4-fluorophenyl)-3-oxopropanimidamide (PubChem CID 58608514) has the molecular formula C19H21FN2O and a molecular weight of 312.39 g/mol. Its IUPAC name is N'-(2,6-diethylphenyl)-3-(4-fluorophenyl)-3-oxopropanimidamide.
| Compound Name | N'-(2,6-diethylphenyl)-3-(4-fluorophenyl)-3-oxopropanimidamide |
|---|---|
| PubChem CID | 58608514 |
| Molecular Formula | C19H21FN2O |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N'-(2,6-diethylphenyl)-3-(4-fluorophenyl)-3-oxopropanimidamide |
| SMILES | CCc1cccc(CC)c1/N=C(/N)CC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H21FN2O/c1-3-13-6-5-7-14(4-2)19(13)22-18(21)12-17(23)15-8-10-16(20)11-9-15/h5-11H,3-4,12H2,1-2H3,(H2,21,22) |
| InChIKey | JPLWCYVSDMOJGA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|