C17H16F3N3O — CID 164626704
N'-[3-(2-aminophenyl)-3-oxopropyl]-4-(trifluoromethyl)benzenecarboximidamide (PubChem CID 164626704) has the molecular formula C17H16F3N3O and a molecular weight of 335.33 g/mol. Its IUPAC name is N'-[3-(2-aminophenyl)-3-oxopropyl]-4-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | N'-[3-(2-aminophenyl)-3-oxopropyl]-4-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 164626704 |
| Molecular Formula | C17H16F3N3O |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | N'-[3-(2-aminophenyl)-3-oxopropyl]-4-(trifluoromethyl)benzenecarboximidamide |
| SMILES | N/C(=N\CCC(=O)c1ccccc1N)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H16F3N3O/c18-17(19,20)12-7-5-11(6-8-12)16(22)23-10-9-15(24)13-3-1-2-4-14(13)21/h1-8H,9-10,21H2,(H2,22,23) |
| InChIKey | FQRSYBSCBOAIIT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|