C17H14ClFN4O — CID 135746731
7-chloro-5-(2-fluorophenyl)-N-hydroxy-N'-methyl-3H-1,4-benzodiazepine-2-carboximidamide (PubChem CID 135746731) has the molecular formula C17H14ClFN4O and a molecular weight of 344.78 g/mol. Its IUPAC name is 7-chloro-5-(2-fluorophenyl)-N-hydroxy-N'-methyl-3H-1,4-benzodiazepine-2-carboximidamide.
| Compound Name | 7-chloro-5-(2-fluorophenyl)-N-hydroxy-N'-methyl-3H-1,4-benzodiazepine-2-carboximidamide |
|---|---|
| PubChem CID | 135746731 |
| Molecular Formula | C17H14ClFN4O |
| Molecular Weight | 344.78 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 7-chloro-5-(2-fluorophenyl)-N-hydroxy-N'-methyl-3H-1,4-benzodiazepine-2-carboximidamide |
| SMILES | C/N=C(\NO)C1=Nc2ccc(Cl)cc2C(c2ccccc2F)=NC1 |
| InChI | InChI=1S/C17H14ClFN4O/c1-20-17(23-24)15-9-21-16(11-4-2-3-5-13(11)19)12-8-10(18)6-7-14(12)22-15/h2-8,24H,9H2,1H3,(H,20,23) |
| InChIKey | XOWBXZQRTWGOAN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 69.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|