About 8-chloro-6-(2-fluorophenyl)-1,4-dihydropyrazolo[4,5-d][2]benzazepine
8-chloro-6-(2-fluorophenyl)-1,4-dihydropyrazolo[4,5-d][2]benzazepine (PubChem CID 21431654) has the molecular formula C17H11ClFN3
and a molecular weight of 311.75 g/mol. Its IUPAC name is 8-chloro-6-(2-fluorophenyl)-1,4-dihydropyrazolo[4,5-d][2]benzazepine.
Molecular Properties
| Compound Name | 8-chloro-6-(2-fluorophenyl)-1,4-dihydropyrazolo[4,5-d][2]benzazepine |
| PubChem CID | 21431654 |
| Molecular Formula | C17H11ClFN3 |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 8-chloro-6-(2-fluorophenyl)-1,4-dihydropyrazolo[4,5-d][2]benzazepine |
| SMILES | Fc1ccccc1C1=NCc2cn[nH]c2-c2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H11ClFN3/c18-11-5-6-12-14(7-11)17(13-3-1-2-4-15(13)19)20-8-10-9-21-22-16(10)12/h1-7,9H,8H2,(H,21,22) |
| InChIKey | KQEWDGCPVPIONQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-chloro-6-(2-fluorophenyl)-1,4-dihydropyrazolo[4,5-d][2]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-6-(2-fluorophenyl)-1,4-dihydropyrazolo[4,5-d][2]benzazepine?
The IUPAC name of 8-chloro-6-(2-fluorophenyl)-1,4-dihydropyrazolo[4,5-d][2]benzazepine (CID 21431654) is 8-chloro-6-(2-fluorophenyl)-1,4-dihydropyrazolo[4,5-d][2]benzazepine.
What is the SMILES notation for 8-chloro-6-(2-fluorophenyl)-1,4-dihydropyrazolo[4,5-d][2]benzazepine?
The canonical SMILES for 8-chloro-6-(2-fluorophenyl)-1,4-dihydropyrazolo[4,5-d][2]benzazepine is Fc1ccccc1C1=NCc2cn[nH]c2-c2ccc(Cl)cc21.
What is the InChIKey of 8-chloro-6-(2-fluorophenyl)-1,4-dihydropyrazolo[4,5-d][2]benzazepine?
The InChIKey is KQEWDGCPVPIONQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11ClFN3/c18-11-5-6-12-14(7-11)17(13-3-1-2-4-15(13)19)20-8-10-9-21-22-16(10)12/h1-7,9H,8H2,(H,21,22).
What are the key properties of 8-chloro-6-(2-fluorophenyl)-1,4-dihydropyrazolo[4,5-d][2]benzazepine?
8-chloro-6-(2-fluorophenyl)-1,4-dihydropyrazolo[4,5-d][2]benzazepine has a molecular weight of 311.75 g/mol, XLogP of 4.22, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-6-(2-fluorophenyl)-1,4-dihydropyrazolo[4,5-d][2]benzazepine is sourced from PubChem (CID 21431654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).