C17H11ClFN3O3 — CID 135813221
(2Z)-2-[8-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-yl]-2-hydroxyiminoacetic acid (PubChem CID 135813221) has the molecular formula C17H11ClFN3O3 and a molecular weight of 359.74 g/mol. Its IUPAC name is (2Z)-2-[8-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-yl]-2-hydroxyiminoacetic acid.
| Compound Name | (2Z)-2-[8-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-yl]-2-hydroxyiminoacetic acid |
|---|---|
| PubChem CID | 135813221 |
| Molecular Formula | C17H11ClFN3O3 |
| Molecular Weight | 359.74 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | (2Z)-2-[8-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-yl]-2-hydroxyiminoacetic acid |
| SMILES | O=C(O)/C(=N\O)C1=Nc2cc(Cl)ccc2C(c2ccccc2F)=NC1 |
| InChI | InChI=1S/C17H11ClFN3O3/c18-9-5-6-11-13(7-9)21-14(16(22-25)17(23)24)8-20-15(11)10-3-1-2-4-12(10)19/h1-7,25H,8H2,(H,23,24)/b22-16- |
| InChIKey | CULWGBQWPDRMLW-JWGURIENSA-N |
| XLogP | 3.32 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.74 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|