C18H13ClFN3 — CID 135783985
5-(2-chlorophenyl)-7-fluoro-N-prop-2-ynyl-1,3-dihydro-1,4-benzodiazepin-2-imine (PubChem CID 135783985) has the molecular formula C18H13ClFN3 and a molecular weight of 325.77 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-7-fluoro-N-prop-2-ynyl-1,3-dihydro-1,4-benzodiazepin-2-imine.
| Compound Name | 5-(2-chlorophenyl)-7-fluoro-N-prop-2-ynyl-1,3-dihydro-1,4-benzodiazepin-2-imine |
|---|---|
| PubChem CID | 135783985 |
| Molecular Formula | C18H13ClFN3 |
| Molecular Weight | 325.77 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 5-(2-chlorophenyl)-7-fluoro-N-prop-2-ynyl-1,3-dihydro-1,4-benzodiazepin-2-imine |
| SMILES | C#CC/N=C1\CN=C(c2ccccc2Cl)c2cc(F)ccc2N1 |
| InChI | InChI=1S/C18H13ClFN3/c1-2-9-21-17-11-22-18(13-5-3-4-6-15(13)19)14-10-12(20)7-8-16(14)23-17/h1,3-8,10H,9,11H2,(H,21,23) |
| InChIKey | BMMRQPZLDQMUDU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.77 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|