C16H12BrN3O — CID 135784037
7-bromo-5-(furan-2-yl)-N-prop-2-ynyl-1,3-dihydro-1,4-benzodiazepin-2-imine (PubChem CID 135784037) has the molecular formula C16H12BrN3O and a molecular weight of 342.20 g/mol. Its IUPAC name is 7-bromo-5-(furan-2-yl)-N-prop-2-ynyl-1,3-dihydro-1,4-benzodiazepin-2-imine.
| Compound Name | 7-bromo-5-(furan-2-yl)-N-prop-2-ynyl-1,3-dihydro-1,4-benzodiazepin-2-imine |
|---|---|
| PubChem CID | 135784037 |
| Molecular Formula | C16H12BrN3O |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 7-bromo-5-(furan-2-yl)-N-prop-2-ynyl-1,3-dihydro-1,4-benzodiazepin-2-imine |
| SMILES | C#CC/N=C1\CN=C(c2ccco2)c2cc(Br)ccc2N1 |
| InChI | InChI=1S/C16H12BrN3O/c1-2-7-18-15-10-19-16(14-4-3-8-21-14)12-9-11(17)5-6-13(12)20-15/h1,3-6,8-9H,7,10H2,(H,18,20) |
| InChIKey | BVLDGJMQWCDUKA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 49.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|