C17H17N3 — CID 137079379
N,7-dimethyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-imine (PubChem CID 137079379) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is N,7-dimethyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-imine.
| Compound Name | N,7-dimethyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-imine |
|---|---|
| PubChem CID | 137079379 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | N,7-dimethyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-imine |
| SMILES | C/N=C1\CN=C(c2ccccc2)c2cc(C)ccc2N1 |
| InChI | InChI=1S/C17H17N3/c1-12-8-9-15-14(10-12)17(13-6-4-3-5-7-13)19-11-16(18-2)20-15/h3-10H,11H2,1-2H3,(H,18,20) |
| InChIKey | DGOHOKNTNORROZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|