C23H18N2O — CID 135800941
(3E)-3-benzylidene-7-methyl-5-phenyl-1H-1,4-benzodiazepin-2-one (PubChem CID 135800941) has the molecular formula C23H18N2O and a molecular weight of 338.41 g/mol. Its IUPAC name is (3E)-3-benzylidene-7-methyl-5-phenyl-1H-1,4-benzodiazepin-2-one.
| Compound Name | (3E)-3-benzylidene-7-methyl-5-phenyl-1H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 135800941 |
| Molecular Formula | C23H18N2O |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (3E)-3-benzylidene-7-methyl-5-phenyl-1H-1,4-benzodiazepin-2-one |
| SMILES | Cc1ccc2c(c1)C(c1ccccc1)=N/C(=C/c1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C23H18N2O/c1-16-12-13-20-19(14-16)22(18-10-6-3-7-11-18)24-21(23(26)25-20)15-17-8-4-2-5-9-17/h2-15H,1H3,(H,25,26)/b21-15+ |
| InChIKey | FNWSLOLDVSVIEU-RCCKNPSSSA-N |
| XLogP | 4.83 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|