C22H18ClN3 — CID 136773346
7-chloro-N-(2-methylphenyl)-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-imine (PubChem CID 136773346) has the molecular formula C22H18ClN3 and a molecular weight of 359.86 g/mol. Its IUPAC name is 7-chloro-N-(2-methylphenyl)-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-imine.
| Compound Name | 7-chloro-N-(2-methylphenyl)-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-imine |
|---|---|
| PubChem CID | 136773346 |
| Molecular Formula | C22H18ClN3 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 7-chloro-N-(2-methylphenyl)-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-imine |
| SMILES | Cc1ccccc1/N=C1\CN=C(c2ccccc2)c2cc(Cl)ccc2N1 |
| InChI | InChI=1S/C22H18ClN3/c1-15-7-5-6-10-19(15)25-21-14-24-22(16-8-3-2-4-9-16)18-13-17(23)11-12-20(18)26-21/h2-13H,14H2,1H3,(H,25,26) |
| InChIKey | LLDMTFSXWIVTCU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|