C16H13ClN2O — CID 118572805
(7-chloro-5-phenyl-1H-1,4-benzodiazepin-2-yl)methanol (PubChem CID 118572805) has the molecular formula C16H13ClN2O and a molecular weight of 284.75 g/mol. Its IUPAC name is (7-chloro-5-phenyl-1H-1,4-benzodiazepin-2-yl)methanol.
| Compound Name | (7-chloro-5-phenyl-1H-1,4-benzodiazepin-2-yl)methanol |
|---|---|
| PubChem CID | 118572805 |
| Molecular Formula | C16H13ClN2O |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | (7-chloro-5-phenyl-1H-1,4-benzodiazepin-2-yl)methanol |
| SMILES | OCC1=CN=C(c2ccccc2)c2cc(Cl)ccc2N1 |
| InChI | InChI=1S/C16H13ClN2O/c17-12-6-7-15-14(8-12)16(11-4-2-1-3-5-11)18-9-13(10-20)19-15/h1-9,19-20H,10H2 |
| InChIKey | XGIASDKERMHGNB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |