C18H15ClN2S — CID 139414026
7-chloro-3-cyclopropyl-5-phenyl-1,3-dihydro-1,4-benzodiazepine-2-thione (PubChem CID 139414026) has the molecular formula C18H15ClN2S and a molecular weight of 326.85 g/mol. Its IUPAC name is 7-chloro-3-cyclopropyl-5-phenyl-1,3-dihydro-1,4-benzodiazepine-2-thione.
| Compound Name | 7-chloro-3-cyclopropyl-5-phenyl-1,3-dihydro-1,4-benzodiazepine-2-thione |
|---|---|
| PubChem CID | 139414026 |
| Molecular Formula | C18H15ClN2S |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 7-chloro-3-cyclopropyl-5-phenyl-1,3-dihydro-1,4-benzodiazepine-2-thione |
| SMILES | S=C1Nc2ccc(Cl)cc2C(c2ccccc2)=NC1C1CC1 |
| InChI | InChI=1S/C18H15ClN2S/c19-13-8-9-15-14(10-13)16(11-4-2-1-3-5-11)21-17(12-6-7-12)18(22)20-15/h1-5,8-10,12,17H,6-7H2,(H,20,22) |
| InChIKey | BHMQXKJFOAOBNJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|