C16H14Cl2N4O2S — CID 21317709
N'-[7-chloro-5-(2-chlorophenyl)-3H-thieno[2,3-e][1,4]diazepin-2-yl]-2-hydroxypropanehydrazide (PubChem CID 21317709) has the molecular formula C16H14Cl2N4O2S and a molecular weight of 397.29 g/mol. Its IUPAC name is N'-[7-chloro-5-(2-chlorophenyl)-3H-thieno[2,3-e][1,4]diazepin-2-yl]-2-hydroxypropanehydrazide.
| Compound Name | N'-[7-chloro-5-(2-chlorophenyl)-3H-thieno[2,3-e][1,4]diazepin-2-yl]-2-hydroxypropanehydrazide |
|---|---|
| PubChem CID | 21317709 |
| Molecular Formula | C16H14Cl2N4O2S |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | N'-[7-chloro-5-(2-chlorophenyl)-3H-thieno[2,3-e][1,4]diazepin-2-yl]-2-hydroxypropanehydrazide |
| SMILES | CC(O)C(=O)NNC1=Nc2sc(Cl)cc2C(c2ccccc2Cl)=NC1 |
| InChI | InChI=1S/C16H14Cl2N4O2S/c1-8(23)15(24)22-21-13-7-19-14(9-4-2-3-5-11(9)17)10-6-12(18)25-16(10)20-13/h2-6,8,23H,7H2,1H3,(H,20,21)(H,22,24) |
| InChIKey | KQXBBMVQKIWNKG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 86.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|