C16H15Cl3N2OS — CID 21451007
5-(2-chlorophenyl)-7-ethyl-2,3-dihydrothieno[2,3-e][1,4]diazepine-1-carbonyl chloride;hydrochloride (PubChem CID 21451007) has the molecular formula C16H15Cl3N2OS and a molecular weight of 389.74 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-7-ethyl-2,3-dihydrothieno[2,3-e][1,4]diazepine-1-carbonyl chloride;hydrochloride.
| Compound Name | 5-(2-chlorophenyl)-7-ethyl-2,3-dihydrothieno[2,3-e][1,4]diazepine-1-carbonyl chloride;hydrochloride |
|---|---|
| PubChem CID | 21451007 |
| Molecular Formula | C16H15Cl3N2OS |
| Molecular Weight | 389.74 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | 5-(2-chlorophenyl)-7-ethyl-2,3-dihydrothieno[2,3-e][1,4]diazepine-1-carbonyl chloride;hydrochloride |
| SMILES | CCc1cc2c(s1)N(C(=O)Cl)CCN=C2c1ccccc1Cl.Cl |
| InChI | InChI=1S/C16H14Cl2N2OS.ClH/c1-2-10-9-12-14(11-5-3-4-6-13(11)17)19-7-8-20(16(18)21)15(12)22-10;/h3-6,9H,2,7-8H2,1H3;1H |
| InChIKey | TWOZDETWJSCPEV-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.74 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|