C17H14ClN5OS — CID 3087287
2-[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]acetamide (PubChem CID 3087287) has the molecular formula C17H14ClN5OS and a molecular weight of 371.85 g/mol. Its IUPAC name is 2-[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]acetamide.
| Compound Name | 2-[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]acetamide |
|---|---|
| PubChem CID | 3087287 |
| Molecular Formula | C17H14ClN5OS |
| Molecular Weight | 371.85 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 2-[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]acetamide |
| SMILES | Cc1nnc2n1-c1sc(CC(N)=O)cc1C(c1ccccc1Cl)=NC2 |
| InChI | InChI=1S/C17H14ClN5OS/c1-9-21-22-15-8-20-16(11-4-2-3-5-13(11)18)12-6-10(7-14(19)24)25-17(12)23(9)15/h2-6H,7-8H2,1H3,(H2,19,24) |
| InChIKey | WLFHFBDLDHNWDD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 86.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.85 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |