C19H19ClN4O3S2 — CID 54216995
3-[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]propyl methanesulfonate (PubChem CID 54216995) has the molecular formula C19H19ClN4O3S2 and a molecular weight of 450.97 g/mol. Its IUPAC name is 3-[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]propyl methanesulfonate.
| Compound Name | 3-[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]propyl methanesulfonate |
|---|---|
| PubChem CID | 54216995 |
| Molecular Formula | C19H19ClN4O3S2 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 3-[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]propyl methanesulfonate |
| SMILES | Cc1nnc2n1-c1sc(CCCOS(C)(=O)=O)cc1C(c1ccccc1Cl)=NC2 |
| InChI | InChI=1S/C19H19ClN4O3S2/c1-12-22-23-17-11-21-18(14-7-3-4-8-16(14)20)15-10-13(28-19(15)24(12)17)6-5-9-27-29(2,25)26/h3-4,7-8,10H,5-6,9,11H2,1-2H3 |
| InChIKey | PZWQCMQTJKULCY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 86.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|