C26H20ClN5O2S — CID 67727950
2-[2-[7-(2-chlorophenyl)-4-ethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl]ethyl]isoindole-1,3-dione (PubChem CID 67727950) has the molecular formula C26H20ClN5O2S and a molecular weight of 502.00 g/mol. Its IUPAC name is 2-[2-[7-(2-chlorophenyl)-4-ethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[7-(2-chlorophenyl)-4-ethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67727950 |
| Molecular Formula | C26H20ClN5O2S |
| Molecular Weight | 502.00 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | 2-[2-[7-(2-chlorophenyl)-4-ethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl]ethyl]isoindole-1,3-dione |
| SMILES | CCc1cc2c(s1)-n1c(CCN3C(=O)c4ccccc4C3=O)nnc1CN=C2c1ccccc1Cl |
| InChI | InChI=1S/C26H20ClN5O2S/c1-2-15-13-19-23(18-9-5-6-10-20(18)27)28-14-22-30-29-21(32(22)26(19)35-15)11-12-31-24(33)16-7-3-4-8-17(16)25(31)34/h3-10,13H,2,11-12,14H2,1H3 |
| InChIKey | ZPJQMXKTQMYMTF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 80.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.00 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|