C25H23ClN6O2S — CID 67728158
1-[[7-(2-chlorophenyl)-4-ethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl]methyl]-3-(4-methoxyphenyl)urea (PubChem CID 67728158) has the molecular formula C25H23ClN6O2S and a molecular weight of 507.02 g/mol. Its IUPAC name is 1-[[7-(2-chlorophenyl)-4-ethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl]methyl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[[7-(2-chlorophenyl)-4-ethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl]methyl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 67728158 |
| Molecular Formula | C25H23ClN6O2S |
| Molecular Weight | 507.02 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 1-[[7-(2-chlorophenyl)-4-ethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl]methyl]-3-(4-methoxyphenyl)urea |
| SMILES | CCc1cc2c(s1)-n1c(nnc1CNC(=O)Nc1ccc(OC)cc1)CN=C2c1ccccc1Cl |
| InChI | InChI=1S/C25H23ClN6O2S/c1-3-17-12-19-23(18-6-4-5-7-20(18)26)27-13-21-30-31-22(32(21)24(19)35-17)14-28-25(33)29-15-8-10-16(34-2)11-9-15/h4-12H,3,13-14H2,1-2H3,(H2,28,29,33) |
| InChIKey | BBTHNXUEDCDOTA-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.02 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |