C26H22N6OS — CID 67728007
N-[(4-ethyl-7-phenyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl)methyl]-1H-indole-2-carboxamide (PubChem CID 67728007) has the molecular formula C26H22N6OS and a molecular weight of 466.57 g/mol. Its IUPAC name is N-[(4-ethyl-7-phenyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl)methyl]-1H-indole-2-carboxamide.
| Compound Name | N-[(4-ethyl-7-phenyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl)methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 67728007 |
| Molecular Formula | C26H22N6OS |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | N-[(4-ethyl-7-phenyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl)methyl]-1H-indole-2-carboxamide |
| SMILES | CCc1cc2c(s1)-n1c(nnc1CNC(=O)c1cc3ccccc3[nH]1)CN=C2c1ccccc1 |
| InChI | InChI=1S/C26H22N6OS/c1-2-18-13-19-24(16-8-4-3-5-9-16)27-14-22-30-31-23(32(22)26(19)34-18)15-28-25(33)21-12-17-10-6-7-11-20(17)29-21/h3-13,29H,2,14-15H2,1H3,(H,28,33) |
| InChIKey | STXSQGHFTGHLGM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |