C37H31ClN6O3S — CID 139710248
benzyl (4R)-4-[7-(2-chlorophenyl)-4-cyclopropyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl]-4-(1H-indole-2-carbonylamino)butanoate (PubChem CID 139710248) has the molecular formula C37H31ClN6O3S and a molecular weight of 675.21 g/mol. Its IUPAC name is benzyl (4R)-4-[7-(2-chlorophenyl)-4-cyclopropyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl]-4-(1H-indole-2-carbonylamino)butanoate.
| Compound Name | benzyl (4R)-4-[7-(2-chlorophenyl)-4-cyclopropyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl]-4-(1H-indole-2-carbonylamino)butanoate |
|---|---|
| PubChem CID | 139710248 |
| Molecular Formula | C37H31ClN6O3S |
| Molecular Weight | 675.21 g/mol |
| Exact Mass | 674.19 |
| IUPAC Name | benzyl (4R)-4-[7-(2-chlorophenyl)-4-cyclopropyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl]-4-(1H-indole-2-carbonylamino)butanoate |
| SMILES | O=C(CC[C@@H](NC(=O)c1cc2ccccc2[nH]1)c1nnc2n1-c1sc(C3CC3)cc1C(c1ccccc1Cl)=NC2)OCc1ccccc1 |
| InChI | InChI=1S/C37H31ClN6O3S/c38-27-12-6-5-11-25(27)34-26-19-31(23-14-15-23)48-37(26)44-32(20-39-34)42-43-35(44)29(16-17-33(45)47-21-22-8-2-1-3-9-22)41-36(46)30-18-24-10-4-7-13-28(24)40-30/h1-13,18-19,23,29,40H,14-17,20-21H2,(H,41,46)/t29-/m1/s1 |
| InChIKey | JOBTYZJZWRUICH-GDLZYMKVSA-N |
| XLogP | 7.69 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.21 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |