C27H26N4O5 — CID 15453070
benzyl N-[1-[2-(1H-indole-2-carbonyl)hydrazinyl]-3-(4-methoxyphenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 15453070) has the molecular formula C27H26N4O5 and a molecular weight of 486.53 g/mol. Its IUPAC name is benzyl N-[1-[2-(1H-indole-2-carbonyl)hydrazinyl]-3-(4-methoxyphenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[2-(1H-indole-2-carbonyl)hydrazinyl]-3-(4-methoxyphenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 15453070 |
| Molecular Formula | C27H26N4O5 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | benzyl N-[1-[2-(1H-indole-2-carbonyl)hydrazinyl]-3-(4-methoxyphenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | COc1ccc(CC(NC(=O)OCc2ccccc2)C(=O)NNC(=O)c2cc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C27H26N4O5/c1-35-21-13-11-18(12-14-21)15-23(29-27(34)36-17-19-7-3-2-4-8-19)25(32)30-31-26(33)24-16-20-9-5-6-10-22(20)28-24/h2-14,16,23,28H,15,17H2,1H3,(H,29,34)(H,30,32)(H,31,33) |
| InChIKey | LDFJDSCMOYSOTD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 121.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|