C28H27N3O5 — CID 11431698
ethyl 2-[[2-(1H-indole-2-carbonylamino)benzoyl]amino]-3-(4-methoxyphenyl)propanoate (PubChem CID 11431698) has the molecular formula C28H27N3O5 and a molecular weight of 485.54 g/mol. Its IUPAC name is ethyl 2-[[2-(1H-indole-2-carbonylamino)benzoyl]amino]-3-(4-methoxyphenyl)propanoate.
| Compound Name | ethyl 2-[[2-(1H-indole-2-carbonylamino)benzoyl]amino]-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 11431698 |
| Molecular Formula | C28H27N3O5 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | ethyl 2-[[2-(1H-indole-2-carbonylamino)benzoyl]amino]-3-(4-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(OC)cc1)NC(=O)c1ccccc1NC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C28H27N3O5/c1-3-36-28(34)25(16-18-12-14-20(35-2)15-13-18)31-26(32)21-9-5-7-11-23(21)30-27(33)24-17-19-8-4-6-10-22(19)29-24/h4-15,17,25,29H,3,16H2,1-2H3,(H,30,33)(H,31,32) |
| InChIKey | YORWLSRKSVXKDX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |