C36H35N3O4 — CID 15068488
benzyl (4S)-5-[bis(4-methylphenyl)methylamino]-4-(1H-indole-2-carbonylamino)-5-oxopentanoate (PubChem CID 15068488) has the molecular formula C36H35N3O4 and a molecular weight of 573.69 g/mol. Its IUPAC name is benzyl (4S)-5-[bis(4-methylphenyl)methylamino]-4-(1H-indole-2-carbonylamino)-5-oxopentanoate.
| Compound Name | benzyl (4S)-5-[bis(4-methylphenyl)methylamino]-4-(1H-indole-2-carbonylamino)-5-oxopentanoate |
|---|---|
| PubChem CID | 15068488 |
| Molecular Formula | C36H35N3O4 |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.26 |
| IUPAC Name | benzyl (4S)-5-[bis(4-methylphenyl)methylamino]-4-(1H-indole-2-carbonylamino)-5-oxopentanoate |
| SMILES | Cc1ccc(C(NC(=O)[C@H](CCC(=O)OCc2ccccc2)NC(=O)c2cc3ccccc3[nH]2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C36H35N3O4/c1-24-12-16-27(17-13-24)34(28-18-14-25(2)15-19-28)39-35(41)31(20-21-33(40)43-23-26-8-4-3-5-9-26)38-36(42)32-22-29-10-6-7-11-30(29)37-32/h3-19,22,31,34,37H,20-21,23H2,1-2H3,(H,38,42)(H,39,41)/t31-/m0/s1 |
| InChIKey | MCUVZIAFIQRPEE-HKBQPEDESA-N |
| XLogP | 6.31 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |