C15H17N5OS — CID 95179151
N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-1H-indole-2-carboxamide (PubChem CID 95179151) has the molecular formula C15H17N5OS and a molecular weight of 315.40 g/mol. Its IUPAC name is N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-1H-indole-2-carboxamide.
| Compound Name | N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 95179151 |
| Molecular Formula | C15H17N5OS |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-1H-indole-2-carboxamide |
| SMILES | CCn1c(CCNC(=O)c2cc3ccccc3[nH]2)n[nH]c1=S |
| InChI | InChI=1S/C15H17N5OS/c1-2-20-13(18-19-15(20)22)7-8-16-14(21)12-9-10-5-3-4-6-11(10)17-12/h3-6,9,17H,2,7-8H2,1H3,(H,16,21)(H,19,22) |
| InChIKey | LEIPOVWBLRDYPY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 78.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|