C13H12N4O2 — CID 103744016
N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1H-indole-2-carboxamide (PubChem CID 103744016) has the molecular formula C13H12N4O2 and a molecular weight of 256.26 g/mol. Its IUPAC name is N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1H-indole-2-carboxamide.
| Compound Name | N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 103744016 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N-[2-(1,2,4-oxadiazol-5-yl)ethyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NCCc1ncno1)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C13H12N4O2/c18-13(14-6-5-12-15-8-16-19-12)11-7-9-3-1-2-4-10(9)17-11/h1-4,7-8,17H,5-6H2,(H,14,18) |
| InChIKey | HHJZPQIYRMVPGF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |