C10H9ClN4O2 — CID 103744039
6-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyridine-2-carboxamide (PubChem CID 103744039) has the molecular formula C10H9ClN4O2 and a molecular weight of 252.66 g/mol. Its IUPAC name is 6-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 103744039 |
| Molecular Formula | C10H9ClN4O2 |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 6-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyridine-2-carboxamide |
| SMILES | O=C(NCCc1ncno1)c1cccc(Cl)n1 |
| InChI | InChI=1S/C10H9ClN4O2/c11-8-3-1-2-7(15-8)10(16)12-5-4-9-13-6-14-17-9/h1-3,6H,4-5H2,(H,12,16) |
| InChIKey | PLZAAUIHZYTIKG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|