C9H9ClN4O — CID 106405558
6-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyridin-2-amine (PubChem CID 106405558) has the molecular formula C9H9ClN4O and a molecular weight of 224.65 g/mol. Its IUPAC name is 6-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyridin-2-amine.
| Compound Name | 6-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 106405558 |
| Molecular Formula | C9H9ClN4O |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 6-chloro-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyridin-2-amine |
| SMILES | Clc1cccc(NCCc2ncno2)n1 |
| InChI | InChI=1S/C9H9ClN4O/c10-7-2-1-3-8(14-7)11-5-4-9-12-6-13-15-9/h1-3,6H,4-5H2,(H,11,14) |
| InChIKey | BOJVZPAWZOQAHA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|