C10H12N4O2 — CID 106403802
5-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyridin-2-amine (PubChem CID 106403802) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 5-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyridin-2-amine.
| Compound Name | 5-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 106403802 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 5-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]pyridin-2-amine |
| SMILES | COc1ccc(NCCc2ncno2)nc1 |
| InChI | InChI=1S/C10H12N4O2/c1-15-8-2-3-9(12-6-8)11-5-4-10-13-7-14-16-10/h2-3,6-7H,4-5H2,1H3,(H,11,12) |
| InChIKey | KTKTWAGNWHFIAP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |