C13H12N4O — CID 103744283
N-[2-(1,2,4-oxadiazol-5-yl)ethyl]quinolin-2-amine (PubChem CID 103744283) has the molecular formula C13H12N4O and a molecular weight of 240.27 g/mol. Its IUPAC name is N-[2-(1,2,4-oxadiazol-5-yl)ethyl]quinolin-2-amine.
| Compound Name | N-[2-(1,2,4-oxadiazol-5-yl)ethyl]quinolin-2-amine |
|---|---|
| PubChem CID | 103744283 |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | N-[2-(1,2,4-oxadiazol-5-yl)ethyl]quinolin-2-amine |
| SMILES | c1ccc2nc(NCCc3ncno3)ccc2c1 |
| InChI | InChI=1S/C13H12N4O/c1-2-4-11-10(3-1)5-6-12(17-11)14-8-7-13-15-9-16-18-13/h1-6,9H,7-8H2,(H,14,17) |
| InChIKey | WPRLZDDPCNAPPR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |