C15H10Cl2N4OS — CID 21317687
[4-chloro-7-(2-chlorophenyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl]methanol (PubChem CID 21317687) has the molecular formula C15H10Cl2N4OS and a molecular weight of 365.25 g/mol. Its IUPAC name is [4-chloro-7-(2-chlorophenyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl]methanol.
| Compound Name | [4-chloro-7-(2-chlorophenyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl]methanol |
|---|---|
| PubChem CID | 21317687 |
| Molecular Formula | C15H10Cl2N4OS |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | [4-chloro-7-(2-chlorophenyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-13-yl]methanol |
| SMILES | OCc1nnc2n1-c1sc(Cl)cc1C(c1ccccc1Cl)=NC2 |
| InChI | InChI=1S/C15H10Cl2N4OS/c16-10-4-2-1-3-8(10)14-9-5-11(17)23-15(9)21-12(6-18-14)19-20-13(21)7-22/h1-5,22H,6-7H2 |
| InChIKey | GPHZJWFNJOTVNI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |