C29H31ClN4S — CID 14721144
7-(2-chlorophenyl)-13-methyl-4-[4-[4-(2-methylpropyl)phenyl]butyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 14721144) has the molecular formula C29H31ClN4S and a molecular weight of 503.12 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-13-methyl-4-[4-[4-(2-methylpropyl)phenyl]butyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | 7-(2-chlorophenyl)-13-methyl-4-[4-[4-(2-methylpropyl)phenyl]butyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 14721144 |
| Molecular Formula | C29H31ClN4S |
| Molecular Weight | 503.12 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 7-(2-chlorophenyl)-13-methyl-4-[4-[4-(2-methylpropyl)phenyl]butyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | Cc1nnc2n1-c1sc(CCCCc3ccc(CC(C)C)cc3)cc1C(c1ccccc1Cl)=NC2 |
| InChI | InChI=1S/C29H31ClN4S/c1-19(2)16-22-14-12-21(13-15-22)8-4-5-9-23-17-25-28(24-10-6-7-11-26(24)30)31-18-27-33-32-20(3)34(27)29(25)35-23/h6-7,10-15,17,19H,4-5,8-9,16,18H2,1-3H3 |
| InChIKey | CDIYYRPFIXXTEL-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.12 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|