C26H34N4OS — CID 22163615
4-decyl-7-(2-methoxyphenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 22163615) has the molecular formula C26H34N4OS and a molecular weight of 450.65 g/mol. Its IUPAC name is 4-decyl-7-(2-methoxyphenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | 4-decyl-7-(2-methoxyphenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 22163615 |
| Molecular Formula | C26H34N4OS |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 4-decyl-7-(2-methoxyphenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | CCCCCCCCCCc1cc2c(s1)-n1c(C)nnc1CN=C2c1ccccc1OC |
| InChI | InChI=1S/C26H34N4OS/c1-4-5-6-7-8-9-10-11-14-20-17-22-25(21-15-12-13-16-23(21)31-3)27-18-24-29-28-19(2)30(24)26(22)32-20/h12-13,15-17H,4-11,14,18H2,1-3H3 |
| InChIKey | NHGDGAGNFHVDBW-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|