C19H21ClN2OS — CID 135493512
5-(2-chlorophenyl)-7-hexyl-1,3-dihydrothieno[2,3-e][1,4]diazepin-2-one (PubChem CID 135493512) has the molecular formula C19H21ClN2OS and a molecular weight of 360.91 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-7-hexyl-1,3-dihydrothieno[2,3-e][1,4]diazepin-2-one.
| Compound Name | 5-(2-chlorophenyl)-7-hexyl-1,3-dihydrothieno[2,3-e][1,4]diazepin-2-one |
|---|---|
| PubChem CID | 135493512 |
| Molecular Formula | C19H21ClN2OS |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 5-(2-chlorophenyl)-7-hexyl-1,3-dihydrothieno[2,3-e][1,4]diazepin-2-one |
| SMILES | CCCCCCc1cc2c(s1)NC(=O)CN=C2c1ccccc1Cl |
| InChI | InChI=1S/C19H21ClN2OS/c1-2-3-4-5-8-13-11-15-18(14-9-6-7-10-16(14)20)21-12-17(23)22-19(15)24-13/h6-7,9-11H,2-5,8,12H2,1H3,(H,22,23) |
| InChIKey | JFMINNVHQCVDJF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|