C22H24ClN3S — CID 143211327
5-(2-chlorophenyl)-8-pentyl-2-sulfanylidene-1,3-dihydro-1,4-benzodiazepine-7-carbonitrile;methane (PubChem CID 143211327) has the molecular formula C22H24ClN3S and a molecular weight of 397.98 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-8-pentyl-2-sulfanylidene-1,3-dihydro-1,4-benzodiazepine-7-carbonitrile;methane.
| Compound Name | 5-(2-chlorophenyl)-8-pentyl-2-sulfanylidene-1,3-dihydro-1,4-benzodiazepine-7-carbonitrile;methane |
|---|---|
| PubChem CID | 143211327 |
| Molecular Formula | C22H24ClN3S |
| Molecular Weight | 397.98 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 5-(2-chlorophenyl)-8-pentyl-2-sulfanylidene-1,3-dihydro-1,4-benzodiazepine-7-carbonitrile;methane |
| SMILES | C.CCCCCc1cc2c(cc1C#N)C(c1ccccc1Cl)=NCC(=S)N2 |
| InChI | InChI=1S/C21H20ClN3S.CH4/c1-2-3-4-7-14-11-19-17(10-15(14)12-23)21(24-13-20(26)25-19)16-8-5-6-9-18(16)22;/h5-6,8-11H,2-4,7,13H2,1H3,(H,25,26);1H4 |
| InChIKey | NTDMKQHEVYYPEF-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.98 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|