C27H29ClN2S2 — CID 135528118
5-(2-chlorophenyl)-7-[2-(4-hexylphenyl)ethyl]-1,3-dihydrothieno[2,3-e][1,4]diazepine-2-thione (PubChem CID 135528118) has the molecular formula C27H29ClN2S2 and a molecular weight of 481.13 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-7-[2-(4-hexylphenyl)ethyl]-1,3-dihydrothieno[2,3-e][1,4]diazepine-2-thione.
| Compound Name | 5-(2-chlorophenyl)-7-[2-(4-hexylphenyl)ethyl]-1,3-dihydrothieno[2,3-e][1,4]diazepine-2-thione |
|---|---|
| PubChem CID | 135528118 |
| Molecular Formula | C27H29ClN2S2 |
| Molecular Weight | 481.13 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 5-(2-chlorophenyl)-7-[2-(4-hexylphenyl)ethyl]-1,3-dihydrothieno[2,3-e][1,4]diazepine-2-thione |
| SMILES | CCCCCCc1ccc(CCc2cc3c(s2)NC(=S)CN=C3c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C27H29ClN2S2/c1-2-3-4-5-8-19-11-13-20(14-12-19)15-16-21-17-23-26(22-9-6-7-10-24(22)28)29-18-25(31)30-27(23)32-21/h6-7,9-14,17H,2-5,8,15-16,18H2,1H3,(H,30,31) |
| InChIKey | XGVWJEBHDIUNIY-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.13 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|