C20H18ClN5O2S — CID 3064647
[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]-morpholin-4-ylmethanone (PubChem CID 3064647) has the molecular formula C20H18ClN5O2S and a molecular weight of 427.92 g/mol. Its IUPAC name is [7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 3064647 |
| Molecular Formula | C20H18ClN5O2S |
| Molecular Weight | 427.92 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | [7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]-morpholin-4-ylmethanone |
| SMILES | Cc1nnc2n1-c1sc(C(=O)N3CCOCC3)cc1C(c1ccccc1Cl)=NC2 |
| InChI | InChI=1S/C20H18ClN5O2S/c1-12-23-24-17-11-22-18(13-4-2-3-5-15(13)21)14-10-16(29-20(14)26(12)17)19(27)25-6-8-28-9-7-25/h2-5,10H,6-9,11H2,1H3 |
| InChIKey | AZHYLABGKBWMMK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 72.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.92 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |