C22H21FN6O4S — CID 169080591
methyl 3-[(4S)-1-(2-aminoethylsulfanyl)-6-(2-fluorophenyl)-8-nitro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]propanoate (PubChem CID 169080591) has the molecular formula C22H21FN6O4S and a molecular weight of 484.51 g/mol. Its IUPAC name is methyl 3-[(4S)-1-(2-aminoethylsulfanyl)-6-(2-fluorophenyl)-8-nitro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]propanoate.
| Compound Name | methyl 3-[(4S)-1-(2-aminoethylsulfanyl)-6-(2-fluorophenyl)-8-nitro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]propanoate |
|---|---|
| PubChem CID | 169080591 |
| Molecular Formula | C22H21FN6O4S |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | methyl 3-[(4S)-1-(2-aminoethylsulfanyl)-6-(2-fluorophenyl)-8-nitro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]propanoate |
| SMILES | COC(=O)CC[C@@H]1N=C(c2ccccc2F)c2cc([N+](=O)[O-])ccc2-n2c(SCCN)nnc21 |
| InChI | InChI=1S/C22H21FN6O4S/c1-33-19(30)9-7-17-21-26-27-22(34-11-10-24)28(21)18-8-6-13(29(31)32)12-15(18)20(25-17)14-4-2-3-5-16(14)23/h2-6,8,12,17H,7,9-11,24H2,1H3/t17-/m0/s1 |
| InChIKey | VHSRLWGRNJFPMW-KRWDZBQOSA-N |
| XLogP | 3.21 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|