C23H24FN5O4S — CID 170207565
methyl 3-[(3S)-5-(2-fluorophenyl)-2-imino-7-nitro-1-(C-propylsulfanylcarbonimidoyl)-3H-1,4-benzodiazepin-3-yl]propanoate (PubChem CID 170207565) has the molecular formula C23H24FN5O4S and a molecular weight of 485.54 g/mol. Its IUPAC name is methyl 3-[(3S)-5-(2-fluorophenyl)-2-imino-7-nitro-1-(C-propylsulfanylcarbonimidoyl)-3H-1,4-benzodiazepin-3-yl]propanoate.
| Compound Name | methyl 3-[(3S)-5-(2-fluorophenyl)-2-imino-7-nitro-1-(C-propylsulfanylcarbonimidoyl)-3H-1,4-benzodiazepin-3-yl]propanoate |
|---|---|
| PubChem CID | 170207565 |
| Molecular Formula | C23H24FN5O4S |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | methyl 3-[(3S)-5-(2-fluorophenyl)-2-imino-7-nitro-1-(C-propylsulfanylcarbonimidoyl)-3H-1,4-benzodiazepin-3-yl]propanoate |
| SMILES | [H]/N=C(\SCCC)N1/C(=N/[H])[C@H](CCC(=O)OC)N=C(c2ccccc2F)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C23H24FN5O4S/c1-3-12-34-23(26)28-19-10-8-14(29(31)32)13-16(19)21(15-6-4-5-7-17(15)24)27-18(22(28)25)9-11-20(30)33-2/h4-8,10,13,18,25-26H,3,9,11-12H2,1-2H3/b25-22+,26-23-/t18-/m0/s1 |
| InChIKey | WTCHBFMXEAKMBF-LMVDXEDLSA-N |
| XLogP | 4.77 |
| TPSA | 132.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|