C26H30N6O5S — CID 170208106
methyl 3-[(3S)-2-imino-1-[C-(2-morpholin-4-ylethylsulfanyl)carbonimidoyl]-7-nitro-5-phenyl-3H-1,4-benzodiazepin-3-yl]propanoate (PubChem CID 170208106) has the molecular formula C26H30N6O5S and a molecular weight of 538.63 g/mol. Its IUPAC name is methyl 3-[(3S)-2-imino-1-[C-(2-morpholin-4-ylethylsulfanyl)carbonimidoyl]-7-nitro-5-phenyl-3H-1,4-benzodiazepin-3-yl]propanoate.
| Compound Name | methyl 3-[(3S)-2-imino-1-[C-(2-morpholin-4-ylethylsulfanyl)carbonimidoyl]-7-nitro-5-phenyl-3H-1,4-benzodiazepin-3-yl]propanoate |
|---|---|
| PubChem CID | 170208106 |
| Molecular Formula | C26H30N6O5S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | methyl 3-[(3S)-2-imino-1-[C-(2-morpholin-4-ylethylsulfanyl)carbonimidoyl]-7-nitro-5-phenyl-3H-1,4-benzodiazepin-3-yl]propanoate |
| SMILES | [H]/N=C(\SCCN1CCOCC1)N1/C(=N/[H])[C@H](CCC(=O)OC)N=C(c2ccccc2)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C26H30N6O5S/c1-36-23(33)10-8-21-25(27)31(26(28)38-16-13-30-11-14-37-15-12-30)22-9-7-19(32(34)35)17-20(22)24(29-21)18-5-3-2-4-6-18/h2-7,9,17,21,27-28H,8,10-16H2,1H3/b27-25+,28-26-/t21-/m0/s1 |
| InChIKey | XAKSUYMESYDSOT-SJBRXVEHSA-N |
| XLogP | 3.55 |
| TPSA | 145.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|