C20H21N3O2 — CID 21416074
1-(cyclobutylmethyl)-7-nitro-5-phenyl-2,3-dihydro-1,4-benzodiazepine (PubChem CID 21416074) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-7-nitro-5-phenyl-2,3-dihydro-1,4-benzodiazepine.
| Compound Name | 1-(cyclobutylmethyl)-7-nitro-5-phenyl-2,3-dihydro-1,4-benzodiazepine |
|---|---|
| PubChem CID | 21416074 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-(cyclobutylmethyl)-7-nitro-5-phenyl-2,3-dihydro-1,4-benzodiazepine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C(c1ccccc1)=NCCN2CC1CCC1 |
| InChI | InChI=1S/C20H21N3O2/c24-23(25)17-9-10-19-18(13-17)20(16-7-2-1-3-8-16)21-11-12-22(19)14-15-5-4-6-15/h1-3,7-10,13,15H,4-6,11-12,14H2 |
| InChIKey | OQQDEOOSCUBBKL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|