C26H18ClN5O5 — CID 21441597
(4-nitrophenyl) 3-(9-chloro-1-oxo-7-phenyl-5H-[1,2,4]triazino[4,3-a][1,4]benzodiazepin-2-yl)propanoate (PubChem CID 21441597) has the molecular formula C26H18ClN5O5 and a molecular weight of 515.91 g/mol. Its IUPAC name is (4-nitrophenyl) 3-(9-chloro-1-oxo-7-phenyl-5H-[1,2,4]triazino[4,3-a][1,4]benzodiazepin-2-yl)propanoate.
| Compound Name | (4-nitrophenyl) 3-(9-chloro-1-oxo-7-phenyl-5H-[1,2,4]triazino[4,3-a][1,4]benzodiazepin-2-yl)propanoate |
|---|---|
| PubChem CID | 21441597 |
| Molecular Formula | C26H18ClN5O5 |
| Molecular Weight | 515.91 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | (4-nitrophenyl) 3-(9-chloro-1-oxo-7-phenyl-5H-[1,2,4]triazino[4,3-a][1,4]benzodiazepin-2-yl)propanoate |
| SMILES | O=C(CCc1nnc2n(c1=O)-c1ccc(Cl)cc1C(c1ccccc1)=NC2)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H18ClN5O5/c27-17-6-12-22-20(14-17)25(16-4-2-1-3-5-16)28-15-23-30-29-21(26(34)31(22)23)11-13-24(33)37-19-9-7-18(8-10-19)32(35)36/h1-10,12,14H,11,13,15H2 |
| InChIKey | RCTWWVNFBLNGLK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 129.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.91 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|