C26H28F2N6O3 — CID 21441609
7-(2,6-difluorophenyl)-2-[3-(dipropylamino)propyl]-9-nitro-5H-[1,2,4]triazino[4,3-a][1,4]benzodiazepin-1-one (PubChem CID 21441609) has the molecular formula C26H28F2N6O3 and a molecular weight of 510.55 g/mol. Its IUPAC name is 7-(2,6-difluorophenyl)-2-[3-(dipropylamino)propyl]-9-nitro-5H-[1,2,4]triazino[4,3-a][1,4]benzodiazepin-1-one.
| Compound Name | 7-(2,6-difluorophenyl)-2-[3-(dipropylamino)propyl]-9-nitro-5H-[1,2,4]triazino[4,3-a][1,4]benzodiazepin-1-one |
|---|---|
| PubChem CID | 21441609 |
| Molecular Formula | C26H28F2N6O3 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 7-(2,6-difluorophenyl)-2-[3-(dipropylamino)propyl]-9-nitro-5H-[1,2,4]triazino[4,3-a][1,4]benzodiazepin-1-one |
| SMILES | CCCN(CCC)CCCc1nnc2n(c1=O)-c1ccc([N+](=O)[O-])cc1C(c1c(F)cccc1F)=NC2 |
| InChI | InChI=1S/C26H28F2N6O3/c1-3-12-32(13-4-2)14-6-9-21-26(35)33-22-11-10-17(34(36)37)15-18(22)25(29-16-23(33)31-30-21)24-19(27)7-5-8-20(24)28/h5,7-8,10-11,15H,3-4,6,9,12-14,16H2,1-2H3 |
| InChIKey | VGLIAHKRVWEFMN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 106.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|