C15H10ClFN2O — CID 154087652
1-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-one (PubChem CID 154087652) has the molecular formula C15H10ClFN2O and a molecular weight of 288.71 g/mol. Its IUPAC name is 1-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-one.
| Compound Name | 1-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 154087652 |
| Molecular Formula | C15H10ClFN2O |
| Molecular Weight | 288.71 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 1-chloro-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-one |
| SMILES | O=C1CN=C(c2ccccc2F)c2ccccc2N1Cl |
| InChI | InChI=1S/C15H10ClFN2O/c16-19-13-8-4-2-6-11(13)15(18-9-14(19)20)10-5-1-3-7-12(10)17/h1-8H,9H2 |
| InChIKey | WFDVEEFNHQOBRK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.71 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|